C18H20O — CID 15635013
(E,3R)-1,5-diphenylhex-4-en-3-ol (PubChem CID 15635013) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (E,3R)-1,5-diphenylhex-4-en-3-ol.
| Compound Name | (E,3R)-1,5-diphenylhex-4-en-3-ol |
|---|---|
| PubChem CID | 15635013 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (E,3R)-1,5-diphenylhex-4-en-3-ol |
| SMILES | C/C(=C\[C@H](O)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O/c1-15(17-10-6-3-7-11-17)14-18(19)13-12-16-8-4-2-5-9-16/h2-11,14,18-19H,12-13H2,1H3/b15-14+/t18-/m1/s1 |
| InChIKey | JAHIPQXNHHKLNF-LGHUBQEGSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |