C12H16O2 — CID 44613846
(E,2S,3R)-1,2-dideuterio-5-phenylhex-4-ene-2,3-diol (PubChem CID 44613846) has the molecular formula C12H16O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (E,2S,3R)-1,2-dideuterio-5-phenylhex-4-ene-2,3-diol.
| Compound Name | (E,2S,3R)-1,2-dideuterio-5-phenylhex-4-ene-2,3-diol |
|---|---|
| PubChem CID | 44613846 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (E,2S,3R)-1,2-dideuterio-5-phenylhex-4-ene-2,3-diol |
| SMILES | [2H]C[C@]([2H])(O)[C@H](O)/C=C(\C)c1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-9(8-12(14)10(2)13)11-6-4-3-5-7-11/h3-8,10,12-14H,1-2H3/b9-8+/t10-,12+/m0/s1/i2D,10D |
| InChIKey | XAQLNNXDQJBIRJ-VJWXFCTQSA-N |
| XLogP | 1.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |