C21H24O — CID 11652243
(2E,4S,5R,6R)-5-methyl-2,6-diphenylocta-2,7-dien-4-ol (PubChem CID 11652243) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is (2E,4S,5R,6R)-5-methyl-2,6-diphenylocta-2,7-dien-4-ol.
| Compound Name | (2E,4S,5R,6R)-5-methyl-2,6-diphenylocta-2,7-dien-4-ol |
|---|---|
| PubChem CID | 11652243 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2E,4S,5R,6R)-5-methyl-2,6-diphenylocta-2,7-dien-4-ol |
| SMILES | C=C[C@@H](c1ccccc1)[C@@H](C)[C@H](O)/C=C(\C)c1ccccc1 |
| InChI | InChI=1S/C21H24O/c1-4-20(19-13-9-6-10-14-19)17(3)21(22)15-16(2)18-11-7-5-8-12-18/h4-15,17,20-22H,1H2,2-3H3/b16-15+/t17-,20-,21-/m1/s1 |
| InChIKey | JTRNUGOFLHWKCK-LRNIZNFSSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|