C28H43NO2 — CID 70579563
2-(dimethylamino)ethyl 3-benzyl-5,9,13-trimethyltetradeca-4,8,12-trienoate (PubChem CID 70579563) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-benzyl-5,9,13-trimethyltetradeca-4,8,12-trienoate.
| Compound Name | 2-(dimethylamino)ethyl 3-benzyl-5,9,13-trimethyltetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 70579563 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-benzyl-5,9,13-trimethyltetradeca-4,8,12-trienoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(CC(=O)OCCN(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C28H43NO2/c1-23(2)12-10-13-24(3)14-11-15-25(4)20-27(21-26-16-8-7-9-17-26)22-28(30)31-19-18-29(5)6/h7-9,12,14,16-17,20,27H,10-11,13,15,18-19,21-22H2,1-6H3 |
| InChIKey | YBSYNCUCWNKFJY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|