C17H31NO2 — CID 173462610
13-(dimethylamino)-5,9-dimethyltrideca-4,8-dienoic acid (PubChem CID 173462610) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 13-(dimethylamino)-5,9-dimethyltrideca-4,8-dienoic acid.
| Compound Name | 13-(dimethylamino)-5,9-dimethyltrideca-4,8-dienoic acid |
|---|---|
| PubChem CID | 173462610 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 13-(dimethylamino)-5,9-dimethyltrideca-4,8-dienoic acid |
| SMILES | CC(=CCCC(=O)O)CCC=C(C)CCCCN(C)C |
| InChI | InChI=1S/C17H31NO2/c1-15(9-5-6-14-18(3)4)10-7-11-16(2)12-8-13-17(19)20/h10,12H,5-9,11,13-14H2,1-4H3,(H,19,20) |
| InChIKey | PHNABQAIRRWCQG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|