C18H31NO4 — CID 88845440
2-[(2E,6E)-11-(dimethylamino)-3,7-dimethylundeca-2,6-dienyl]propanedioic acid (PubChem CID 88845440) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[(2E,6E)-11-(dimethylamino)-3,7-dimethylundeca-2,6-dienyl]propanedioic acid.
| Compound Name | 2-[(2E,6E)-11-(dimethylamino)-3,7-dimethylundeca-2,6-dienyl]propanedioic acid |
|---|---|
| PubChem CID | 88845440 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-[(2E,6E)-11-(dimethylamino)-3,7-dimethylundeca-2,6-dienyl]propanedioic acid |
| SMILES | C/C(=C\CC(C(=O)O)C(=O)O)CC/C=C(\C)CCCCN(C)C |
| InChI | InChI=1S/C18H31NO4/c1-14(8-5-6-13-19(3)4)9-7-10-15(2)11-12-16(17(20)21)18(22)23/h9,11,16H,5-8,10,12-13H2,1-4H3,(H,20,21)(H,22,23)/b14-9+,15-11+ |
| InChIKey | JSRAIKLHUSWOSI-YFVJMOTDSA-N |
| XLogP | 3.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|