C19H30N2 — CID 175165479
1-N-(3,7-dimethylocta-2,6-dienyl)-3-phenylpropane-1,2-diamine (PubChem CID 175165479) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-N-(3,7-dimethylocta-2,6-dienyl)-3-phenylpropane-1,2-diamine.
| Compound Name | 1-N-(3,7-dimethylocta-2,6-dienyl)-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 175165479 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-N-(3,7-dimethylocta-2,6-dienyl)-3-phenylpropane-1,2-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCC(N)Cc1ccccc1 |
| InChI | InChI=1S/C19H30N2/c1-16(2)8-7-9-17(3)12-13-21-15-19(20)14-18-10-5-4-6-11-18/h4-6,8,10-12,19,21H,7,9,13-15,20H2,1-3H3 |
| InChIKey | DCORSIMWDSVWKN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|