C24H33N3 — CID 154963240
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[phenyl(pyridin-3-yl)methyl]ethane-1,2-diamine (PubChem CID 154963240) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[phenyl(pyridin-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[phenyl(pyridin-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154963240 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[phenyl(pyridin-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCNC(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C24H33N3/c1-20(2)9-7-10-21(3)14-16-25-17-18-27-24(22-11-5-4-6-12-22)23-13-8-15-26-19-23/h4-6,8-9,11-15,19,24-25,27H,7,10,16-18H2,1-3H3/b21-14+ |
| InChIKey | INOOJZYRNXNQGX-KGENOOAVSA-N |
| XLogP | 5.04 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|