C16H25N — CID 174610966
2,6-dimethylnona-2,6-diene;pyridine (PubChem CID 174610966) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2,6-dimethylnona-2,6-diene;pyridine.
| Compound Name | 2,6-dimethylnona-2,6-diene;pyridine |
|---|---|
| PubChem CID | 174610966 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2,6-dimethylnona-2,6-diene;pyridine |
| SMILES | CCC=C(C)CCC=C(C)C.c1ccncc1 |
| InChI | InChI=1S/C11H20.C5H5N/c1-5-7-11(4)9-6-8-10(2)3;1-2-4-6-5-3-1/h7-8H,5-6,9H2,1-4H3;1-5H |
| InChIKey | HGVFEFCDQQVLOD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|