C28H43N3O — CID 22154336
1-(1-pyridin-4-ylethyl)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea (PubChem CID 22154336) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 1-(1-pyridin-4-ylethyl)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea.
| Compound Name | 1-(1-pyridin-4-ylethyl)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea |
|---|---|
| PubChem CID | 22154336 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 1-(1-pyridin-4-ylethyl)-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CNC(=O)NC(C)c1ccncc1 |
| InChI | InChI=1S/C28H43N3O/c1-22(2)10-7-11-23(3)12-8-13-24(4)14-9-15-25(5)16-21-30-28(32)31-26(6)27-17-19-29-20-18-27/h10,12,14,16-20,26H,7-9,11,13,15,21H2,1-6H3,(H2,30,31,32)/b23-12+,24-14+,25-16+ |
| InChIKey | UFFAXGGHWDABSV-JZQMSYLWSA-N |
| XLogP | 7.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|