C27H40N2O — CID 14834790
2-pyridin-4-yl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide (PubChem CID 14834790) has the molecular formula C27H40N2O and a molecular weight of 408.63 g/mol. Its IUPAC name is 2-pyridin-4-yl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide.
| Compound Name | 2-pyridin-4-yl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide |
|---|---|
| PubChem CID | 14834790 |
| Molecular Formula | C27H40N2O |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 2-pyridin-4-yl-N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CNC(=O)Cc1ccncc1 |
| InChI | InChI=1S/C27H40N2O/c1-22(2)9-6-10-23(3)11-7-12-24(4)13-8-14-25(5)15-20-29-27(30)21-26-16-18-28-19-17-26/h9,11,13,15-19H,6-8,10,12,14,20-21H2,1-5H3,(H,29,30)/b23-11+,24-13+,25-15+ |
| InChIKey | ANPYIKKOKQHEBX-NHPINGLRSA-N |
| XLogP | 6.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|