C18H27N3O2 — CID 136930441
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide (PubChem CID 136930441) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 136930441 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)acetamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)Cc1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C18H27N3O2/c1-12(2)7-6-8-13(3)9-10-19-17(22)11-16-14(4)20-15(5)21-18(16)23/h7,9H,6,8,10-11H2,1-5H3,(H,19,22)(H,20,21,23)/b13-9+ |
| InChIKey | XDTLVWVEDMZREU-UKTHLTGXSA-N |
| XLogP | 2.74 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|