About [naphthalen-1-yl(phenyl)methyl] disulfanylformate
[naphthalen-1-yl(phenyl)methyl] disulfanylformate (PubChem CID 163815998) has the molecular formula C18H14O2S2
and a molecular weight of 326.44 g/mol. Its IUPAC name is [naphthalen-1-yl(phenyl)methyl] disulfanylformate.
Molecular Properties
| Compound Name | [naphthalen-1-yl(phenyl)methyl] disulfanylformate |
| PubChem CID | 163815998 |
| Molecular Formula | C18H14O2S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [naphthalen-1-yl(phenyl)methyl] disulfanylformate |
| SMILES | O=C(OC(c1ccccc1)c1cccc2ccccc12)SS |
| InChI | InChI=1S/C18H14O2S2/c19-18(22-21)20-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16/h1-12,17,21H |
| InChIKey | NRJSVJCHUGVNMH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [naphthalen-1-yl(phenyl)methyl] disulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [naphthalen-1-yl(phenyl)methyl] disulfanylformate?
The IUPAC name of [naphthalen-1-yl(phenyl)methyl] disulfanylformate (CID 163815998) is [naphthalen-1-yl(phenyl)methyl] disulfanylformate.
What is the SMILES notation for [naphthalen-1-yl(phenyl)methyl] disulfanylformate?
The canonical SMILES for [naphthalen-1-yl(phenyl)methyl] disulfanylformate is O=C(OC(c1ccccc1)c1cccc2ccccc12)SS.
What is the InChIKey of [naphthalen-1-yl(phenyl)methyl] disulfanylformate?
The InChIKey is NRJSVJCHUGVNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2S2/c19-18(22-21)20-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16/h1-12,17,21H.
What are the key properties of [naphthalen-1-yl(phenyl)methyl] disulfanylformate?
[naphthalen-1-yl(phenyl)methyl] disulfanylformate has a molecular weight of 326.44 g/mol, XLogP of 5.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [naphthalen-1-yl(phenyl)methyl] disulfanylformate is sourced from PubChem (CID 163815998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).