C18H12F6N2O2 — CID 146169161
3-[(2S)-1,1,1-trifluoro-3-nitro-2-[4-(trifluoromethyl)phenyl]propan-2-yl]-1H-indole (PubChem CID 146169161) has the molecular formula C18H12F6N2O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 3-[(2S)-1,1,1-trifluoro-3-nitro-2-[4-(trifluoromethyl)phenyl]propan-2-yl]-1H-indole.
| Compound Name | 3-[(2S)-1,1,1-trifluoro-3-nitro-2-[4-(trifluoromethyl)phenyl]propan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 146169161 |
| Molecular Formula | C18H12F6N2O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-[(2S)-1,1,1-trifluoro-3-nitro-2-[4-(trifluoromethyl)phenyl]propan-2-yl]-1H-indole |
| SMILES | O=[N+]([O-])C[C@](c1ccc(C(F)(F)F)cc1)(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C18H12F6N2O2/c19-17(20,21)12-7-5-11(6-8-12)16(10-26(27)28,18(22,23)24)14-9-25-15-4-2-1-3-13(14)15/h1-9,25H,10H2/t16-/m0/s1 |
| InChIKey | WKZVEPQERHRHCB-INIZCTEOSA-N |
| XLogP | 5.31 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|