C20H20N2O4 — CID 122214202
methyl (2R)-2-(1H-indol-3-yl)-2-(nitromethyl)-4-phenylbutanoate (PubChem CID 122214202) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl (2R)-2-(1H-indol-3-yl)-2-(nitromethyl)-4-phenylbutanoate.
| Compound Name | methyl (2R)-2-(1H-indol-3-yl)-2-(nitromethyl)-4-phenylbutanoate |
|---|---|
| PubChem CID | 122214202 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl (2R)-2-(1H-indol-3-yl)-2-(nitromethyl)-4-phenylbutanoate |
| SMILES | COC(=O)[C@@](CCc1ccccc1)(C[N+](=O)[O-])c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O4/c1-26-19(23)20(14-22(24)25,12-11-15-7-3-2-4-8-15)17-13-21-18-10-6-5-9-16(17)18/h2-10,13,21H,11-12,14H2,1H3/t20-/m0/s1 |
| InChIKey | KCMXRBRULODYJW-FQEVSTJZSA-N |
| XLogP | 3.49 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|