C23H20N2O4S — CID 162405715
benzyl (2R)-2-(1H-indol-3-yl)-2-(methoxycarbonylamino)-2-thiophen-3-ylacetate (PubChem CID 162405715) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is benzyl (2R)-2-(1H-indol-3-yl)-2-(methoxycarbonylamino)-2-thiophen-3-ylacetate.
| Compound Name | benzyl (2R)-2-(1H-indol-3-yl)-2-(methoxycarbonylamino)-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 162405715 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | benzyl (2R)-2-(1H-indol-3-yl)-2-(methoxycarbonylamino)-2-thiophen-3-ylacetate |
| SMILES | COC(=O)N[C@@](C(=O)OCc1ccccc1)(c1ccsc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H20N2O4S/c1-28-22(27)25-23(17-11-12-30-15-17,19-13-24-20-10-6-5-9-18(19)20)21(26)29-14-16-7-3-2-4-8-16/h2-13,15,24H,14H2,1H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | LNQWGOJWFQGNRD-QHCPKHFHSA-N |
| XLogP | 4.57 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |