About 2-chloropyridine;3-(trifluoromethyl)-1H-indole
2-chloropyridine;3-(trifluoromethyl)-1H-indole (PubChem CID 158415901) has the molecular formula C14H10ClF3N2
and a molecular weight of 298.70 g/mol. Its IUPAC name is 2-chloropyridine;3-(trifluoromethyl)-1H-indole.
Molecular Properties
| Compound Name | 2-chloropyridine;3-(trifluoromethyl)-1H-indole |
| PubChem CID | 158415901 |
| Molecular Formula | C14H10ClF3N2 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-chloropyridine;3-(trifluoromethyl)-1H-indole |
| SMILES | Clc1ccccn1.FC(F)(F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C9H6F3N.C5H4ClN/c10-9(11,12)7-5-13-8-4-2-1-3-6(7)8;6-5-3-1-2-4-7-5/h1-5,13H;1-4H |
| InChIKey | GZWUNZFDLPCOMX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropyridine;3-(trifluoromethyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyridine;3-(trifluoromethyl)-1H-indole?
The IUPAC name of 2-chloropyridine;3-(trifluoromethyl)-1H-indole (CID 158415901) is 2-chloropyridine;3-(trifluoromethyl)-1H-indole.
What is the SMILES notation for 2-chloropyridine;3-(trifluoromethyl)-1H-indole?
The canonical SMILES for 2-chloropyridine;3-(trifluoromethyl)-1H-indole is Clc1ccccn1.FC(F)(F)c1c[nH]c2ccccc12.
What is the InChIKey of 2-chloropyridine;3-(trifluoromethyl)-1H-indole?
The InChIKey is GZWUNZFDLPCOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N.C5H4ClN/c10-9(11,12)7-5-13-8-4-2-1-3-6(7)8;6-5-3-1-2-4-7-5/h1-5,13H;1-4H.
What are the key properties of 2-chloropyridine;3-(trifluoromethyl)-1H-indole?
2-chloropyridine;3-(trifluoromethyl)-1H-indole has a molecular weight of 298.70 g/mol, XLogP of 4.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyridine;3-(trifluoromethyl)-1H-indole is sourced from PubChem (CID 158415901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).