C23H17Cl2N3O2 — CID 1493686
2,2-bis(4-chlorophenyl)-2-hydroxy-N-(1H-indol-3-ylmethylideneamino)acetamide (PubChem CID 1493686) has the molecular formula C23H17Cl2N3O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-2-hydroxy-N-(1H-indol-3-ylmethylideneamino)acetamide.
| Compound Name | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-(1H-indol-3-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1493686 |
| Molecular Formula | C23H17Cl2N3O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-2-hydroxy-N-(1H-indol-3-ylmethylideneamino)acetamide |
| SMILES | O=C(NN=Cc1c[nH]c2ccccc12)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O2/c24-18-9-5-16(6-10-18)23(30,17-7-11-19(25)12-8-17)22(29)28-27-14-15-13-26-21-4-2-1-3-20(15)21/h1-14,26,30H,(H,28,29) |
| InChIKey | VAVVJIGUGHDWNF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|