C15H16F2N2O — CID 121021872
N-(4,4-difluorocyclohexyl)-1H-indole-3-carboxamide (PubChem CID 121021872) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-1H-indole-3-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 121021872 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-1H-indole-3-carboxamide |
| SMILES | O=C(NC1CCC(F)(F)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H16F2N2O/c16-15(17)7-5-10(6-8-15)19-14(20)12-9-18-13-4-2-1-3-11(12)13/h1-4,9-10,18H,5-8H2,(H,19,20) |
| InChIKey | IDPWHWVHIWTJOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |