C24H26FN3O2 — CID 11711207
N-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexyl]-2-(1H-indol-3-yl)-2-oxoacetamide (PubChem CID 11711207) has the molecular formula C24H26FN3O2 and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexyl]-2-(1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 11711207 |
| Molecular Formula | C24H26FN3O2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexyl]-2-(1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CN(C)C1(c2cccc(F)c2)CCC(NC(=O)C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C24H26FN3O2/c1-28(2)24(16-6-5-7-17(25)14-16)12-10-18(11-13-24)27-23(30)22(29)20-15-26-21-9-4-3-8-19(20)21/h3-9,14-15,18,26H,10-13H2,1-2H3,(H,27,30) |
| InChIKey | NMBWYIGIOCHPFY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|