C27H33ClFN3O — CID 11712508
2-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexylidene]-N-[1-(1H-indol-3-yl)propan-2-yl]acetamide;hydrochloride (PubChem CID 11712508) has the molecular formula C27H33ClFN3O and a molecular weight of 470.03 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexylidene]-N-[1-(1H-indol-3-yl)propan-2-yl]acetamide;hydrochloride.
| Compound Name | 2-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexylidene]-N-[1-(1H-indol-3-yl)propan-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 11712508 |
| Molecular Formula | C27H33ClFN3O |
| Molecular Weight | 470.03 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[4-(dimethylamino)-4-(3-fluorophenyl)cyclohexylidene]-N-[1-(1H-indol-3-yl)propan-2-yl]acetamide;hydrochloride |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC(=O)C=C1CCC(c2cccc(F)c2)(N(C)C)CC1.Cl |
| InChI | InChI=1S/C27H32FN3O.ClH/c1-19(15-21-18-29-25-10-5-4-9-24(21)25)30-26(32)16-20-11-13-27(14-12-20,31(2)3)22-7-6-8-23(28)17-22;/h4-10,16-19,29H,11-15H2,1-3H3,(H,30,32);1H/b20-16-; |
| InChIKey | KCIOTZNIJIPFON-LRZQPWDCSA-N |
| XLogP | 5.73 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.03 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|