C25H31ClN4O — CID 11604570
2-[4-(dimethylamino)-4-pyridin-2-ylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride (PubChem CID 11604570) has the molecular formula C25H31ClN4O and a molecular weight of 439.00 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-4-pyridin-2-ylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-[4-(dimethylamino)-4-pyridin-2-ylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 11604570 |
| Molecular Formula | C25H31ClN4O |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-[4-(dimethylamino)-4-pyridin-2-ylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride |
| SMILES | CN(C)C1(c2ccccn2)CCC(=CC(=O)NCCc2c[nH]c3ccccc23)CC1.Cl |
| InChI | InChI=1S/C25H30N4O.ClH/c1-29(2)25(23-9-5-6-15-26-23)13-10-19(11-14-25)17-24(30)27-16-12-20-18-28-22-8-4-3-7-21(20)22;/h3-9,15,17-18,28H,10-14,16H2,1-2H3,(H,27,30);1H/b19-17-; |
| InChIKey | VOYLFEWMTNNWFF-HGMLFDQWSA-N |
| XLogP | 4.60 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|