C26H34N4OS — CID 87738701
1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-1-sulfanylurea (PubChem CID 87738701) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-1-sulfanylurea.
| Compound Name | 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87738701 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 1-[[4-(dimethylamino)-4-phenylcyclohexyl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-1-sulfanylurea |
| SMILES | CN(C)C1(c2ccccc2)CCC(CN(S)C(=O)NCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H34N4OS/c1-29(2)26(22-8-4-3-5-9-22)15-12-20(13-16-26)19-30(32)25(31)27-17-14-21-18-28-24-11-7-6-10-23(21)24/h3-11,18,20,28,32H,12-17,19H2,1-2H3,(H,27,31) |
| InChIKey | LQSNQVSCWAIFJH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|