C28H35N3O — CID 69335635
2-[4-(dimethylamino)-4-phenylcyclohexylidene]-6-(1H-indol-3-yl)hexanamide (PubChem CID 69335635) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-4-phenylcyclohexylidene]-6-(1H-indol-3-yl)hexanamide.
| Compound Name | 2-[4-(dimethylamino)-4-phenylcyclohexylidene]-6-(1H-indol-3-yl)hexanamide |
|---|---|
| PubChem CID | 69335635 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 2-[4-(dimethylamino)-4-phenylcyclohexylidene]-6-(1H-indol-3-yl)hexanamide |
| SMILES | CN(C)C1(c2ccccc2)CCC(=C(CCCCc2c[nH]c3ccccc23)C(N)=O)CC1 |
| InChI | InChI=1S/C28H35N3O/c1-31(2)28(23-11-4-3-5-12-23)18-16-21(17-19-28)25(27(29)32)14-7-6-10-22-20-30-26-15-9-8-13-24(22)26/h3-5,8-9,11-13,15,20,30H,6-7,10,14,16-19H2,1-2H3,(H2,29,32)/b25-21- |
| InChIKey | FURZKHYXUVDKEF-DAFNUICNSA-N |
| XLogP | 5.69 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|