C28H35N3O3 — CID 90969466
2-[[2-[4-(dimethylamino)-4-phenylcyclohexyl]acetyl]amino]-4-(1H-indol-3-yl)butanoic acid (PubChem CID 90969466) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylamino)-4-phenylcyclohexyl]acetyl]amino]-4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-[[2-[4-(dimethylamino)-4-phenylcyclohexyl]acetyl]amino]-4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 90969466 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-[[2-[4-(dimethylamino)-4-phenylcyclohexyl]acetyl]amino]-4-(1H-indol-3-yl)butanoic acid |
| SMILES | CN(C)C1(c2ccccc2)CCC(CC(=O)NC(CCc2c[nH]c3ccccc23)C(=O)O)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-31(2)28(22-8-4-3-5-9-22)16-14-20(15-17-28)18-26(32)30-25(27(33)34)13-12-21-19-29-24-11-7-6-10-23(21)24/h3-11,19-20,25,29H,12-18H2,1-2H3,(H,30,32)(H,33,34) |
| InChIKey | VRSQNMKWZDGAHU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |