C26H34N4S — CID 86601794
1-[4-(dimethylamino)-4-phenylcyclohexyl]-3-[1-(1H-indol-3-yl)propan-2-yl]thiourea (PubChem CID 86601794) has the molecular formula C26H34N4S and a molecular weight of 434.65 g/mol. Its IUPAC name is 1-[4-(dimethylamino)-4-phenylcyclohexyl]-3-[1-(1H-indol-3-yl)propan-2-yl]thiourea.
| Compound Name | 1-[4-(dimethylamino)-4-phenylcyclohexyl]-3-[1-(1H-indol-3-yl)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 86601794 |
| Molecular Formula | C26H34N4S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[4-(dimethylamino)-4-phenylcyclohexyl]-3-[1-(1H-indol-3-yl)propan-2-yl]thiourea |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC(=S)NC1CCC(c2ccccc2)(N(C)C)CC1 |
| InChI | InChI=1S/C26H34N4S/c1-19(17-20-18-27-24-12-8-7-11-23(20)24)28-25(31)29-22-13-15-26(16-14-22,30(2)3)21-9-5-4-6-10-21/h4-12,18-19,22,27H,13-17H2,1-3H3,(H2,28,29,31) |
| InChIKey | VRVXSQSGJRXXGA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|