C26H32ClN3O — CID 67386596
(2E)-2-[2-(dimethylamino)-4-phenylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride (PubChem CID 67386596) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is (2E)-2-[2-(dimethylamino)-4-phenylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride.
| Compound Name | (2E)-2-[2-(dimethylamino)-4-phenylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 67386596 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (2E)-2-[2-(dimethylamino)-4-phenylcyclohexylidene]-N-[2-(1H-indol-3-yl)ethyl]acetamide;hydrochloride |
| SMILES | CN(C)C1CC(c2ccccc2)CC/C1=C\C(=O)NCCc1c[nH]c2ccccc12.Cl |
| InChI | InChI=1S/C26H31N3O.ClH/c1-29(2)25-16-20(19-8-4-3-5-9-19)12-13-21(25)17-26(30)27-15-14-22-18-28-24-11-7-6-10-23(22)24;/h3-11,17-18,20,25,28H,12-16H2,1-2H3,(H,27,30);1H/b21-17+; |
| InChIKey | RUDUGHZJJURNDW-DIRYEVLESA-N |
| XLogP | 5.07 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|