About disodium;hydrogen phosphate;1H-indol-3-ol
disodium;hydrogen phosphate;1H-indol-3-ol (PubChem CID 67341741) has the molecular formula C8H8NNa2O5P
and a molecular weight of 275.11 g/mol. Its IUPAC name is disodium;hydrogen phosphate;1H-indol-3-ol.
Molecular Properties
| Compound Name | disodium;hydrogen phosphate;1H-indol-3-ol |
| PubChem CID | 67341741 |
| Molecular Formula | C8H8NNa2O5P |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | disodium;hydrogen phosphate;1H-indol-3-ol |
| SMILES | O=P([O-])([O-])O.Oc1c[nH]c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C8H7NO.2Na.H3O4P/c10-8-5-9-7-4-2-1-3-6(7)8;;;1-5(2,3)4/h1-5,9-10H;;;(H3,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | VBYLPUAWJTXTKF-UHFFFAOYSA-L |
| XLogP | -6.31 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | -6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydrogen phosphate;1H-indol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydrogen phosphate;1H-indol-3-ol?
The IUPAC name of disodium;hydrogen phosphate;1H-indol-3-ol (CID 67341741) is disodium;hydrogen phosphate;1H-indol-3-ol.
What is the SMILES notation for disodium;hydrogen phosphate;1H-indol-3-ol?
The canonical SMILES for disodium;hydrogen phosphate;1H-indol-3-ol is O=P([O-])([O-])O.Oc1c[nH]c2ccccc12.[Na+].[Na+].
What is the InChIKey of disodium;hydrogen phosphate;1H-indol-3-ol?
The InChIKey is VBYLPUAWJTXTKF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H7NO.2Na.H3O4P/c10-8-5-9-7-4-2-1-3-6(7)8;;;1-5(2,3)4/h1-5,9-10H;;;(H3,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;hydrogen phosphate;1H-indol-3-ol?
disodium;hydrogen phosphate;1H-indol-3-ol has a molecular weight of 275.11 g/mol, XLogP of -6.31, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydrogen phosphate;1H-indol-3-ol is sourced from PubChem (CID 67341741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).