C11H12NO6P-2 — CID 46878464
[(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] phosphate (PubChem CID 46878464) has the molecular formula C11H12NO6P-2 and a molecular weight of 285.19 g/mol. Its IUPAC name is [(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] phosphate.
| Compound Name | [(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] phosphate |
|---|---|
| PubChem CID | 46878464 |
| Molecular Formula | C11H12NO6P-2 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | [(2R,3S)-2,3-dihydroxy-3-(1H-indol-3-yl)propyl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@@H](O)[C@@H](O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H14NO6P/c13-10(6-18-19(15,16)17)11(14)8-5-12-9-4-2-1-3-7(8)9/h1-5,10-14H,6H2,(H2,15,16,17)/p-2/t10-,11+/m1/s1 |
| InChIKey | NQEQTYPJSIEPHW-MNOVXSKESA-L |
| XLogP | -0.59 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|