C11H11N5O3 — CID 43839929
4-oxo-1H-quinoline-3,7-dicarbohydrazide (PubChem CID 43839929) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-oxo-1H-quinoline-3,7-dicarbohydrazide.
| Compound Name | 4-oxo-1H-quinoline-3,7-dicarbohydrazide |
|---|---|
| PubChem CID | 43839929 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-oxo-1H-quinoline-3,7-dicarbohydrazide |
| SMILES | NNC(=O)c1ccc2c(=O)c(C(=O)NN)c[nH]c2c1 |
| InChI | InChI=1S/C11H11N5O3/c12-15-10(18)5-1-2-6-8(3-5)14-4-7(9(6)17)11(19)16-13/h1-4H,12-13H2,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | FZOKEFUYXXTGSO-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|