C11H13N3O — CID 53324620
3-(2-amino-1,1,2,2-tetratritioethyl)-1H-indole-5-carboxamide (PubChem CID 53324620) has the molecular formula C11H13N3O and a molecular weight of 211.28 g/mol. Its IUPAC name is 3-(2-amino-1,1,2,2-tetratritioethyl)-1H-indole-5-carboxamide.
| Compound Name | 3-(2-amino-1,1,2,2-tetratritioethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 53324620 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-(2-amino-1,1,2,2-tetratritioethyl)-1H-indole-5-carboxamide |
| SMILES | [3H]C([3H])(N)C([3H])([3H])c1c[nH]c2ccc(C(N)=O)cc12 |
| InChI | InChI=1S/C11H13N3O/c12-4-3-8-6-14-10-2-1-7(11(13)15)5-9(8)10/h1-2,5-6,14H,3-4,12H2,(H2,13,15)/i3T2,4T2 |
| InChIKey | WKZLNEWVIAGNAW-DOMYTETQSA-N |
| XLogP | 0.77 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |