C15H17N3O5 — CID 11709509
3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid (PubChem CID 11709509) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid.
| Compound Name | 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 11709509 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indole-5-carboxamide;(Z)-but-2-enedioic acid |
| SMILES | NCCc1c[nH]c2ccc(C(N)=O)cc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H13N3O.C4H4O4/c12-4-3-8-6-14-10-2-1-7(11(13)15)5-9(8)10;5-3(6)1-2-4(7)8/h1-2,5-6,14H,3-4,12H2,(H2,13,15);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PZQZSWAOVAMBQM-BTJKTKAUSA-N |
| XLogP | 0.48 |
| TPSA | 159.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|