C32H31N5O7 — CID 70382763
4-[[4-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide;but-2-enedioic acid (PubChem CID 70382763) has the molecular formula C32H31N5O7 and a molecular weight of 597.63 g/mol. Its IUPAC name is 4-[[4-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide;but-2-enedioic acid.
| Compound Name | 4-[[4-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 70382763 |
| Molecular Formula | C32H31N5O7 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 4-[[4-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylbenzamide;but-2-enedioic acid |
| SMILES | NCCc1c[nH]c2ccc(CC3NC(=O)N(Cc4ccc(C(=O)Nc5ccccc5)cc4)C3=O)cc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C28H27N5O3.C4H4O4/c29-13-12-21-16-30-24-11-8-19(14-23(21)24)15-25-27(35)33(28(36)32-25)17-18-6-9-20(10-7-18)26(34)31-22-4-2-1-3-5-22;5-3(6)1-2-4(7)8/h1-11,14,16,25,30H,12-13,15,17,29H2,(H,31,34)(H,32,36);1-2H,(H,5,6)(H,7,8) |
| InChIKey | VIKNYSQZDADMOL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|