C25H28N4O7 — CID 67855158
1-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-benzylimidazolidine-2,4-dione;(Z)-but-2-enedioic acid;hydrate (PubChem CID 67855158) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-benzylimidazolidine-2,4-dione;(Z)-but-2-enedioic acid;hydrate.
| Compound Name | 1-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-benzylimidazolidine-2,4-dione;(Z)-but-2-enedioic acid;hydrate |
|---|---|
| PubChem CID | 67855158 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-benzylimidazolidine-2,4-dione;(Z)-but-2-enedioic acid;hydrate |
| SMILES | NCCc1c[nH]c2ccc(CN3CC(=O)N(Cc4ccccc4)C3=O)cc12.O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H22N4O2.C4H4O4.H2O/c22-9-8-17-11-23-19-7-6-16(10-18(17)19)12-24-14-20(26)25(21(24)27)13-15-4-2-1-3-5-15;5-3(6)1-2-4(7)8;/h1-7,10-11,23H,8-9,12-14,22H2;1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | ACHAOUVZBOJSGW-FJOGWHKWSA-N |
| XLogP | 1.52 |
| TPSA | 188.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|