C46H44N8O8 — CID 67855182
bis[3-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-5-benzyl-2,4-dioxoimidazolidin-1-yl] (Z)-but-2-enedioate (PubChem CID 67855182) has the molecular formula C46H44N8O8 and a molecular weight of 836.91 g/mol. Its IUPAC name is bis[3-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-5-benzyl-2,4-dioxoimidazolidin-1-yl] (Z)-but-2-enedioate.
| Compound Name | bis[3-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-5-benzyl-2,4-dioxoimidazolidin-1-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67855182 |
| Molecular Formula | C46H44N8O8 |
| Molecular Weight | 836.91 g/mol |
| Exact Mass | 836.33 |
| IUPAC Name | bis[3-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-5-benzyl-2,4-dioxoimidazolidin-1-yl] (Z)-but-2-enedioate |
| SMILES | NCCc1c[nH]c2ccc(CN3C(=O)C(Cc4ccccc4)N(OC(=O)/C=C\C(=O)ON4C(=O)N(Cc5ccc6[nH]cc(CCN)c6c5)C(=O)C4Cc4ccccc4)C3=O)cc12 |
| InChI | InChI=1S/C46H44N8O8/c47-19-17-33-25-49-37-13-11-31(21-35(33)37)27-51-43(57)39(23-29-7-3-1-4-8-29)53(45(51)59)61-41(55)15-16-42(56)62-54-40(24-30-9-5-2-6-10-30)44(58)52(46(54)60)28-32-12-14-38-36(22-32)34(18-20-48)26-50-38/h1-16,21-22,25-26,39-40,49-50H,17-20,23-24,27-28,47-48H2/b16-15- |
| InChIKey | BMVALVIXGFWTGP-NXVVXOECSA-N |
| XLogP | 4.58 |
| TPSA | 217.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|