C15H18N4O2 — CID 10469232
5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-methylimidazolidine-2,4-dione (PubChem CID 10469232) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10469232 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-[[3-(2-aminoethyl)-1H-indol-5-yl]methyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)NC(Cc2ccc3[nH]cc(CCN)c3c2)C1=O |
| InChI | InChI=1S/C15H18N4O2/c1-19-14(20)13(18-15(19)21)7-9-2-3-12-11(6-9)10(4-5-16)8-17-12/h2-3,6,8,13,17H,4-5,7,16H2,1H3,(H,18,21) |
| InChIKey | DGXUVTNZWRCEAJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|