C26H31N5O3 — CID 10322070
N-[3-[[1-[2-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide (PubChem CID 10322070) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[3-[[1-[2-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[1-[2-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10322070 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-[3-[[1-[2-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CC2NC(=O)N(CCc3ccc4[nH]cc(CCN(C)C)c4c3)C2=O)c1 |
| InChI | InChI=1S/C26H31N5O3/c1-17(32)28-21-6-4-5-19(13-21)15-24-25(33)31(26(34)29-24)12-9-18-7-8-23-22(14-18)20(16-27-23)10-11-30(2)3/h4-8,13-14,16,24,27H,9-12,15H2,1-3H3,(H,28,32)(H,29,34) |
| InChIKey | BDHLPQSDHKSHBU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|