C24H27N5O3 — CID 10094407
N-[3-[[1-[2-[3-(2-aminoethyl)-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide (PubChem CID 10094407) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[3-[[1-[2-[3-(2-aminoethyl)-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[1-[2-[3-(2-aminoethyl)-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10094407 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[3-[[1-[2-[3-(2-aminoethyl)-1H-indol-5-yl]ethyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CC2NC(=O)N(CCc3ccc4[nH]cc(CCN)c4c3)C2=O)c1 |
| InChI | InChI=1S/C24H27N5O3/c1-15(30)27-19-4-2-3-17(11-19)13-22-23(31)29(24(32)28-22)10-8-16-5-6-21-20(12-16)18(7-9-25)14-26-21/h2-6,11-12,14,22,26H,7-10,13,25H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | KFYTUPNCMHZUSF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|