C18H20N4O2 — CID 10019154
5-[(4-hydrazinylphenyl)methyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 10019154) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-[(4-hydrazinylphenyl)methyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(4-hydrazinylphenyl)methyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10019154 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-[(4-hydrazinylphenyl)methyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | NNc1ccc(CC2NC(=O)N(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H20N4O2/c19-21-15-8-6-14(7-9-15)12-16-17(23)22(18(24)20-16)11-10-13-4-2-1-3-5-13/h1-9,16,21H,10-12,19H2,(H,20,24) |
| InChIKey | SRRDZMGHVDTMON-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|