C19H21N5O3 — CID 10361601
N-[4-[[4-[(4-hydrazinylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]phenyl]acetamide (PubChem CID 10361601) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[4-[[4-[(4-hydrazinylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(4-hydrazinylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10361601 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[4-[[4-[(4-hydrazinylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2C(=O)NC(Cc3ccc(NN)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H21N5O3/c1-12(25)21-15-6-4-14(5-7-15)11-24-18(26)17(22-19(24)27)10-13-2-8-16(23-20)9-3-13/h2-9,17,23H,10-11,20H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | NVIUKHDLTOCOOM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|