C29H30N4O3 — CID 10412986
5-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-3-[(4-phenoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 10412986) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-3-[(4-phenoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-3-[(4-phenoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10412986 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 5-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]methyl]-3-[(4-phenoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CN(C)CCc1c[nH]c2ccc(CC3NC(=O)N(Cc4ccc(Oc5ccccc5)cc4)C3=O)cc12 |
| InChI | InChI=1S/C29H30N4O3/c1-32(2)15-14-22-18-30-26-13-10-21(16-25(22)26)17-27-28(34)33(29(35)31-27)19-20-8-11-24(12-9-20)36-23-6-4-3-5-7-23/h3-13,16,18,27,30H,14-15,17,19H2,1-2H3,(H,31,35) |
| InChIKey | LSYXOPPJMZUQIF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|