C21H24N2O6 — CID 19042892
2-[5-(4-methoxyphenoxy)-1H-indol-3-yl]-N,N-dimethylethanamine;oxalic acid (PubChem CID 19042892) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenoxy)-1H-indol-3-yl]-N,N-dimethylethanamine;oxalic acid.
| Compound Name | 2-[5-(4-methoxyphenoxy)-1H-indol-3-yl]-N,N-dimethylethanamine;oxalic acid |
|---|---|
| PubChem CID | 19042892 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[5-(4-methoxyphenoxy)-1H-indol-3-yl]-N,N-dimethylethanamine;oxalic acid |
| SMILES | COc1ccc(Oc2ccc3[nH]cc(CCN(C)C)c3c2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H22N2O2.C2H2O4/c1-21(2)11-10-14-13-20-19-9-8-17(12-18(14)19)23-16-6-4-15(22-3)5-7-16;3-1(4)2(5)6/h4-9,12-13,20H,10-11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | BNBHLECUWSQWLJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|