C16H20N2O6 — CID 90674869
[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl] acetate;oxalic acid (PubChem CID 90674869) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl] acetate;oxalic acid.
| Compound Name | [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl] acetate;oxalic acid |
|---|---|
| PubChem CID | 90674869 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-1H-indol-5-yl] acetate;oxalic acid |
| SMILES | CC(=O)Oc1ccc2[nH]cc(CCN(C)C)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H18N2O2.C2H2O4/c1-10(17)18-12-4-5-14-13(8-12)11(9-15-14)6-7-16(2)3;3-1(4)2(5)6/h4-5,8-9,15H,6-7H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UMWZWVYJJZZIKJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|