C25H32N2O10 — CID 23267950
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]oxane-2-carboxylate (PubChem CID 23267950) has the molecular formula C25H32N2O10 and a molecular weight of 520.54 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 23267950 |
| Molecular Formula | C25H32N2O10 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc3[nH]cc(CCN(C)C)c3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H32N2O10/c1-13(28)33-20-21(34-14(2)29)23(35-15(3)30)25(37-22(20)24(31)32-6)36-17-7-8-19-18(11-17)16(12-26-19)9-10-27(4)5/h7-8,11-12,20-23,25-26H,9-10H2,1-6H3/t20-,21-,22-,23+,25+/m0/s1 |
| InChIKey | YBISEQJIAKOECT-FPDJOHNTSA-N |
| XLogP | 1.34 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|