C25H34N2O3 — CID 85469343
(E)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]-4-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one (PubChem CID 85469343) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is (E)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]-4-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one.
| Compound Name | (E)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]-4-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 85469343 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (E)-4-[[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]oxy]-4-[(4S)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C(/Oc1ccc2[nH]cc(CCN(C)C)c2c1)C1=C(C)C[C@H](O)CC1(C)C |
| InChI | InChI=1S/C25H34N2O3/c1-16-11-19(29)14-25(3,4)24(16)23(12-17(2)28)30-20-7-8-22-21(13-20)18(15-26-22)9-10-27(5)6/h7-8,12-13,15,19,26,29H,9-11,14H2,1-6H3/b23-12+/t19-/m0/s1 |
| InChIKey | QFVJYHIKRGTOMB-DOUQRPAJSA-N |
| XLogP | 4.62 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|