C13H11Br2N3O2 — CID 162890732
(5R)-5-[(5,6-dibromo-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione (PubChem CID 162890732) has the molecular formula C13H11Br2N3O2 and a molecular weight of 401.06 g/mol. Its IUPAC name is (5R)-5-[(5,6-dibromo-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5,6-dibromo-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 162890732 |
| Molecular Formula | C13H11Br2N3O2 |
| Molecular Weight | 401.06 g/mol |
| Exact Mass | 398.92 |
| IUPAC Name | (5R)-5-[(5,6-dibromo-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N[C@H](Cc2c[nH]c3cc(Br)c(Br)cc23)C1=O |
| InChI | InChI=1S/C13H11Br2N3O2/c1-18-12(19)11(17-13(18)20)2-6-5-16-10-4-9(15)8(14)3-7(6)10/h3-5,11,16H,2H2,1H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | VXKJNMYGUSWTKS-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.06 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|