C14H15ClFN3O2 — CID 158503902
(5R)-5-[(7-chloro-5-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione;methane (PubChem CID 158503902) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is (5R)-5-[(7-chloro-5-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione;methane.
| Compound Name | (5R)-5-[(7-chloro-5-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione;methane |
|---|---|
| PubChem CID | 158503902 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (5R)-5-[(7-chloro-5-fluoro-1H-indol-3-yl)methyl]-3-methylimidazolidine-2,4-dione;methane |
| SMILES | C.CN1C(=O)N[C@H](Cc2c[nH]c3c(Cl)cc(F)cc23)C1=O |
| InChI | InChI=1S/C13H11ClFN3O2.CH4/c1-18-12(19)10(17-13(18)20)2-6-5-16-11-8(6)3-7(15)4-9(11)14;/h3-5,10,16H,2H2,1H3,(H,17,20);1H4/t10-;/m1./s1 |
| InChIKey | HKFUOAMKLKFFPW-HNCPQSOCSA-N |
| XLogP | 2.69 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|