C20H18ClF2N3O2 — CID 158095312
(5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione;methane (PubChem CID 158095312) has the molecular formula C20H18ClF2N3O2 and a molecular weight of 405.83 g/mol. Its IUPAC name is (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione;methane.
| Compound Name | (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione;methane |
|---|---|
| PubChem CID | 158095312 |
| Molecular Formula | C20H18ClF2N3O2 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (5R)-5-[(7-chloro-6-fluoro-1H-indol-3-yl)methyl]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione;methane |
| SMILES | C.O=C1N[C@H](Cc2c[nH]c3c(Cl)c(F)ccc23)C(=O)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H14ClF2N3O2.CH4/c20-16-14(22)5-4-13-11(8-23-17(13)16)7-15-18(26)25(19(27)24-15)9-10-2-1-3-12(21)6-10;/h1-6,8,15,23H,7,9H2,(H,24,27);1H4/t15-;/m1./s1 |
| InChIKey | FOPBSKAOSGOZER-XFULWGLBSA-N |
| XLogP | 4.40 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|