C22H20N4O4 — CID 71317607
3,6-bis[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-2,5-dione (PubChem CID 71317607) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3,6-bis[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-2,5-dione.
| Compound Name | 3,6-bis[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 71317607 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3,6-bis[(5-hydroxy-1H-indol-3-yl)methyl]piperazine-2,5-dione |
| SMILES | O=C1NC(Cc2c[nH]c3ccc(O)cc23)C(=O)NC1Cc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C22H20N4O4/c27-13-1-3-17-15(7-13)11(9-23-17)5-19-21(29)26-20(22(30)25-19)6-12-10-24-18-4-2-14(28)8-16(12)18/h1-4,7-10,19-20,23-24,27-28H,5-6H2,(H,25,30)(H,26,29) |
| InChIKey | HASWNCHYBAFUSB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |