C10H12N2O — CID 53317992
3-(2-amino-1,2-ditritioethyl)-1H-indol-5-ol (PubChem CID 53317992) has the molecular formula C10H12N2O and a molecular weight of 180.24 g/mol. Its IUPAC name is 3-(2-amino-1,2-ditritioethyl)-1H-indol-5-ol.
| Compound Name | 3-(2-amino-1,2-ditritioethyl)-1H-indol-5-ol |
|---|---|
| PubChem CID | 53317992 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 3-(2-amino-1,2-ditritioethyl)-1H-indol-5-ol |
| SMILES | [3H]C(N)C([3H])c1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/i3T,4T |
| InChIKey | QZAYGJVTTNCVMB-PZFLKRBQSA-N |
| XLogP | 1.37 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |